C26H27FN4O2S — CID 159925948
1-[2-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-4-fluorophenyl]ethynyl]cyclopropan-1-ol (PubChem CID 159925948) has the molecular formula C26H27FN4O2S and a molecular weight of 478.59 g/mol. Its IUPAC name is 1-[2-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-4-fluorophenyl]ethynyl]cyclopropan-1-ol.
| Compound Name | 1-[2-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-4-fluorophenyl]ethynyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 159925948 |
| Molecular Formula | C26H27FN4O2S |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 1-[2-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-4-fluorophenyl]ethynyl]cyclopropan-1-ol |
| SMILES | CN1CCC(c2ncc(-c3cnc(N)c(OCc4cc(C#CC5(O)CC5)ccc4F)c3)s2)CC1 |
| InChI | InChI=1S/C26H27FN4O2S/c1-31-10-5-18(6-11-31)25-30-15-23(34-25)19-13-22(24(28)29-14-19)33-16-20-12-17(2-3-21(20)27)4-7-26(32)8-9-26/h2-3,12-15,18,32H,5-6,8-11,16H2,1H3,(H2,28,29) |
| InChIKey | QTLOYDNMLAJROF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|