About 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium
1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium (PubChem CID 159926411) has the molecular formula C13H22F6NO4S2+
and a molecular weight of 434.44 g/mol. Its IUPAC name is 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium.
Molecular Properties
| Compound Name | 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium |
| PubChem CID | 159926411 |
| Molecular Formula | C13H22F6NO4S2+ |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium |
| SMILES | CCC[N+]1(CCC)CCC(S(=O)(=O)C(F)(F)F)(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F6NO4S2/c1-3-7-20(8-4-2)9-5-11(6-10-20,25(21,22)12(14,15)16)26(23,24)13(17,18)19/h3-10H2,1-2H3/q+1 |
| InChIKey | AUUJTSZWLGJVIR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium?
The IUPAC name of 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium (CID 159926411) is 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium.
What is the SMILES notation for 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium?
The canonical SMILES for 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium is CCC[N+]1(CCC)CCC(S(=O)(=O)C(F)(F)F)(S(=O)(=O)C(F)(F)F)CC1.
What is the InChIKey of 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium?
The InChIKey is AUUJTSZWLGJVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F6NO4S2/c1-3-7-20(8-4-2)9-5-11(6-10-20,25(21,22)12(14,15)16)26(23,24)13(17,18)19/h3-10H2,1-2H3/q+1.
What are the key properties of 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium?
1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium has a molecular weight of 434.44 g/mol, XLogP of 2.98, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dipropyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium is sourced from PubChem (CID 159926411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).