C28H44BNO5 — CID 159928318
tert-butyl 6-methyl-2-[(3R)-pyrrolidin-3-yl]oxy-5-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]cyclohexa-1,3-diene-1-carboxylate (PubChem CID 159928318) has the molecular formula C28H44BNO5 and a molecular weight of 485.47 g/mol. Its IUPAC name is tert-butyl 6-methyl-2-[(3R)-pyrrolidin-3-yl]oxy-5-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | tert-butyl 6-methyl-2-[(3R)-pyrrolidin-3-yl]oxy-5-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 159928318 |
| Molecular Formula | C28H44BNO5 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | tert-butyl 6-methyl-2-[(3R)-pyrrolidin-3-yl]oxy-5-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]cyclohexa-1,3-diene-1-carboxylate |
| SMILES | CC1C(C(=O)OC(C)(C)C)=C(O[C@@H]2CCNC2)C=CC1CCB1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C28H44BNO5/c1-17-18(10-12-29-34-23-15-19-14-22(27(19,5)6)28(23,7)35-29)8-9-21(32-20-11-13-30-16-20)24(17)25(31)33-26(2,3)4/h8-9,17-20,22-23,30H,10-16H2,1-7H3/t17?,18?,19-,20+,22-,23+,28-/m0/s1 |
| InChIKey | QNLXWKBITXEWEH-VEVJZCNTSA-N |
| XLogP | 4.90 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|