C28H40O5 — CID 159929379
(4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methylpropanoate;(4-hydroxyphenyl) 2-methylpropanoate (PubChem CID 159929379) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methylpropanoate;(4-hydroxyphenyl) 2-methylpropanoate.
| Compound Name | (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methylpropanoate;(4-hydroxyphenyl) 2-methylpropanoate |
|---|---|
| PubChem CID | 159929379 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methylpropanoate;(4-hydroxyphenyl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccc(O)cc1.CCC1(OC(=O)C(C)C)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C18H28O2.C10H12O3/c1-4-18(20-17(19)10(2)3)9-13-8-14(18)16-12-6-5-11(7-12)15(13)16;1-7(2)10(12)13-9-5-3-8(11)4-6-9/h10-16H,4-9H2,1-3H3;3-7,11H,1-2H3 |
| InChIKey | NZLBYZDBBAEOBN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|