C23H34BrN3O7 — CID 159929851
4-bromo-3-hydroxyiminobutan-2-one;4-(3,6-dihydro-2H-pyran-4-yl)morpholine;ethyl 1,4,6,7-tetrahydropyrano[4,3-b]pyrrole-2-carboxylate (PubChem CID 159929851) has the molecular formula C23H34BrN3O7 and a molecular weight of 544.44 g/mol. Its IUPAC name is 4-bromo-3-hydroxyiminobutan-2-one;4-(3,6-dihydro-2H-pyran-4-yl)morpholine;ethyl 1,4,6,7-tetrahydropyrano[4,3-b]pyrrole-2-carboxylate.
| Compound Name | 4-bromo-3-hydroxyiminobutan-2-one;4-(3,6-dihydro-2H-pyran-4-yl)morpholine;ethyl 1,4,6,7-tetrahydropyrano[4,3-b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 159929851 |
| Molecular Formula | C23H34BrN3O7 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 4-bromo-3-hydroxyiminobutan-2-one;4-(3,6-dihydro-2H-pyran-4-yl)morpholine;ethyl 1,4,6,7-tetrahydropyrano[4,3-b]pyrrole-2-carboxylate |
| SMILES | C1=C(N2CCOCC2)CCOC1.CC(=O)C(CBr)=NO.CCOC(=O)c1cc2c([nH]1)CCOC2 |
| InChI | InChI=1S/C10H13NO3.C9H15NO2.C4H6BrNO2/c1-2-14-10(12)9-5-7-6-13-4-3-8(7)11-9;1-5-11-6-2-9(1)10-3-7-12-8-4-10;1-3(7)4(2-5)6-8/h5,11H,2-4,6H2,1H3;1H,2-8H2;8H,2H2,1H3 |
| InChIKey | NZMPACIHARMLMD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|