C17H19NO3 — CID 15993069
N-benzyl-N-ethyl-2,4-dimethyl-6-oxopyran-3-carboxamide (PubChem CID 15993069) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2,4-dimethyl-6-oxopyran-3-carboxamide.
| Compound Name | N-benzyl-N-ethyl-2,4-dimethyl-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 15993069 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-benzyl-N-ethyl-2,4-dimethyl-6-oxopyran-3-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1c(C)cc(=O)oc1C |
| InChI | InChI=1S/C17H19NO3/c1-4-18(11-14-8-6-5-7-9-14)17(20)16-12(2)10-15(19)21-13(16)3/h5-10H,4,11H2,1-3H3 |
| InChIKey | IHRSGDLQARKUQU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |