C8H12N2NaO6S- — CID 159931748
sodium;[(2S,5R)-2-(hydroxymethyl)-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfite;hydroxide (PubChem CID 159931748) has the molecular formula C8H12N2NaO6S- and a molecular weight of 287.25 g/mol. Its IUPAC name is sodium;[(2S,5R)-2-(hydroxymethyl)-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfite;hydroxide.
| Compound Name | sodium;[(2S,5R)-2-(hydroxymethyl)-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfite;hydroxide |
|---|---|
| PubChem CID | 159931748 |
| Molecular Formula | C8H12N2NaO6S- |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | sodium;[(2S,5R)-2-(hydroxymethyl)-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfite;hydroxide |
| SMILES | CC1=C[C@@H](CO)N2C[C@@H]1N(OS(=O)[O-])C2=O.[Na+].[OH-] |
| InChI | InChI=1S/C8H12N2O5S.Na.H2O/c1-5-2-6(4-11)9-3-7(5)10(8(9)12)15-16(13)14;;/h2,6-7,11H,3-4H2,1H3,(H,13,14);;1H2/q;+1;/p-2/t6-,7-;;/m0../s1 |
| InChIKey | BMFCLGBKLDOURT-JFYKYWLVSA-L |
| XLogP | -4.03 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|