C15H24N2 — CID 159932555
1,2,3,4-tetramethylpyrrole;1,3,4-trimethylpyrrole (PubChem CID 159932555) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1,2,3,4-tetramethylpyrrole;1,3,4-trimethylpyrrole.
| Compound Name | 1,2,3,4-tetramethylpyrrole;1,3,4-trimethylpyrrole |
|---|---|
| PubChem CID | 159932555 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1,2,3,4-tetramethylpyrrole;1,3,4-trimethylpyrrole |
| SMILES | Cc1cn(C)c(C)c1C.Cc1cn(C)cc1C |
| InChI | InChI=1S/C8H13N.C7H11N/c1-6-5-9(4)8(3)7(6)2;1-6-4-8(3)5-7(6)2/h5H,1-4H3;4-5H,1-3H3 |
| InChIKey | NZVDTECFIUGANJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |