About 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide
5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide (PubChem CID 15993274) has the molecular formula C15H15ClN2O2
and a molecular weight of 290.75 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 15993274 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cc(-c2cccc(Cl)c2)on1 |
| InChI | InChI=1S/C15H15ClN2O2/c16-11-5-3-4-10(8-11)14-9-13(18-20-14)15(19)17-12-6-1-2-7-12/h3-5,8-9,12H,1-2,6-7H2,(H,17,19) |
| InChIKey | YFQTZIGOORMFOJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide (CID 15993274) is 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide is O=C(NC1CCCC1)c1cc(-c2cccc(Cl)c2)on1.
What is the InChIKey of 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide?
The InChIKey is YFQTZIGOORMFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN2O2/c16-11-5-3-4-10(8-11)14-9-13(18-20-14)15(19)17-12-6-1-2-7-12/h3-5,8-9,12H,1-2,6-7H2,(H,17,19).
What are the key properties of 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide?
5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide has a molecular weight of 290.75 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chlorophenyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 15993274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).