About 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine
4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine (PubChem CID 15993278) has the molecular formula C16H12F3N5O4
and a molecular weight of 395.30 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine |
| PubChem CID | 15993278 |
| Molecular Formula | C16H12F3N5O4 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)nc(-n3cnc([N+](=O)[O-])c3)n2)cc1OC |
| InChI | InChI=1S/C16H12F3N5O4/c1-27-11-4-3-9(5-12(11)28-2)10-6-13(16(17,18)19)22-15(21-10)23-7-14(20-8-23)24(25)26/h3-8H,1-2H3 |
| InChIKey | UJJVFNULZDNJEP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine?
The IUPAC name of 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine (CID 15993278) is 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine?
The canonical SMILES for 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine is COc1ccc(-c2cc(C(F)(F)F)nc(-n3cnc([N+](=O)[O-])c3)n2)cc1OC.
What is the InChIKey of 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine?
The InChIKey is UJJVFNULZDNJEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F3N5O4/c1-27-11-4-3-9(5-12(11)28-2)10-6-13(16(17,18)19)22-15(21-10)23-7-14(20-8-23)24(25)26/h3-8H,1-2H3.
What are the key properties of 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine?
4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine has a molecular weight of 395.30 g/mol, XLogP of 3.27, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxyphenyl)-2-(4-nitroimidazol-1-yl)-6-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 15993278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).