About 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one
3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one (PubChem CID 159933905) has the molecular formula C10H5ClF2N2O3
and a molecular weight of 274.61 g/mol. Its IUPAC name is 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one |
| PubChem CID | 159933905 |
| Molecular Formula | C10H5ClF2N2O3 |
| Molecular Weight | 274.61 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one |
| SMILES | Fc1ccc2onc(Cl)c2c1.O=c1cc(F)o[nH]1 |
| InChI | InChI=1S/C7H3ClFNO.C3H2FNO2/c8-7-5-3-4(9)1-2-6(5)11-10-7;4-2-1-3(6)5-7-2/h1-3H;1H,(H,5,6) |
| InChIKey | NZZKRAQPBYQVQZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one?
The IUPAC name of 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one (CID 159933905) is 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one.
What is the SMILES notation for 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one?
The canonical SMILES for 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one is Fc1ccc2onc(Cl)c2c1.O=c1cc(F)o[nH]1.
What is the InChIKey of 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one?
The InChIKey is NZZKRAQPBYQVQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClFNO.C3H2FNO2/c8-7-5-3-4(9)1-2-6(5)11-10-7;4-2-1-3(6)5-7-2/h1-3H;1H,(H,5,6).
What are the key properties of 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one?
3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one has a molecular weight of 274.61 g/mol, XLogP of 2.73, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-fluoro-1,2-benzoxazole;5-fluoro-1,2-oxazol-3-one is sourced from PubChem (CID 159933905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).