About N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide
N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 15993462) has the molecular formula C22H22N2O4
and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide.
Molecular Properties
| Compound Name | N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide |
| PubChem CID | 15993462 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(N(C(C)=O)C2=C(N(C)C)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H22N2O4/c1-5-28-16-12-10-15(11-13-16)24(14(2)25)20-19(23(3)4)21(26)17-8-6-7-9-18(17)22(20)27/h6-13H,5H2,1-4H3 |
| InChIKey | MKXOFTJGBQVKKG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide?
The IUPAC name of N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide (CID 15993462) is N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide.
What is the SMILES notation for N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide?
The canonical SMILES for N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide is CCOc1ccc(N(C(C)=O)C2=C(N(C)C)C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide?
The InChIKey is MKXOFTJGBQVKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O4/c1-5-28-16-12-10-15(11-13-16)24(14(2)25)20-19(23(3)4)21(26)17-8-6-7-9-18(17)22(20)27/h6-13H,5H2,1-4H3.
What are the key properties of N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide?
N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide has a molecular weight of 378.43 g/mol, XLogP of 3.29, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(dimethylamino)-1,4-dioxonaphthalen-2-yl]-N-(4-ethoxyphenyl)acetamide is sourced from PubChem (CID 15993462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).