About 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione
6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 15993495) has the molecular formula C12H20N4O3
and a molecular weight of 268.32 g/mol. Its IUPAC name is 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione |
| PubChem CID | 15993495 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CCCCNCC(=O)c1c(N)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H20N4O3/c1-4-5-6-14-7-8(17)9-10(13)15(2)12(19)16(3)11(9)18/h14H,4-7,13H2,1-3H3 |
| InChIKey | RHKALUMGEKECGM-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione?
The IUPAC name of 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione (CID 15993495) is 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione is CCCCNCC(=O)c1c(N)n(C)c(=O)n(C)c1=O.
What is the InChIKey of 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione?
The InChIKey is RHKALUMGEKECGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O3/c1-4-5-6-14-7-8(17)9-10(13)15(2)12(19)16(3)11(9)18/h14H,4-7,13H2,1-3H3.
What are the key properties of 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione?
6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione has a molecular weight of 268.32 g/mol, XLogP of -0.76, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-[2-(butylamino)acetyl]-1,3-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 15993495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).