C16H36ClNO4 — CID 159936149
bis(3,3-dihydroxypropyl)-bis(3-methylbutyl)azanium chloride (PubChem CID 159936149) has the molecular formula C16H36ClNO4 and a molecular weight of 341.92 g/mol. Its IUPAC name is bis(3,3-dihydroxypropyl)-bis(3-methylbutyl)azanium chloride.
| Compound Name | bis(3,3-dihydroxypropyl)-bis(3-methylbutyl)azanium chloride |
|---|---|
| PubChem CID | 159936149 |
| Molecular Formula | C16H36ClNO4 |
| Molecular Weight | 341.92 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | bis(3,3-dihydroxypropyl)-bis(3-methylbutyl)azanium chloride |
| SMILES | CC(C)CC[N+](CCC(C)C)(CCC(O)O)CCC(O)O.[Cl-] |
| InChI | InChI=1S/C16H36NO4.ClH/c1-13(2)5-9-17(10-6-14(3)4,11-7-15(18)19)12-8-16(20)21;/h13-16,18-21H,5-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | OAGVAYDQAOXEPY-UHFFFAOYSA-M |
| XLogP | -1.70 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.92 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|