About trizinc;2H-benzotriazole;diphosphate
trizinc;2H-benzotriazole;diphosphate (PubChem CID 159936185) has the molecular formula C6H5N3O8P2Zn3
and a molecular weight of 505.24 g/mol. Its IUPAC name is trizinc;2H-benzotriazole;diphosphate.
Molecular Properties
| Compound Name | trizinc;2H-benzotriazole;diphosphate |
| PubChem CID | 159936185 |
| Molecular Formula | C6H5N3O8P2Zn3 |
| Molecular Weight | 505.24 g/mol |
| Exact Mass | 500.74 |
| IUPAC Name | trizinc;2H-benzotriazole;diphosphate |
| SMILES | O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Zn+2].[Zn+2].[Zn+2].c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.2H3O4P.3Zn/c1-2-4-6-5(3-1)7-9-8-6;2*1-5(2,3)4;;;/h1-4H,(H,7,8,9);2*(H3,1,2,3,4);;;/q;;;3*+2/p-6 |
| InChIKey | OAGXUZWVNJMKKU-UHFFFAOYSA-H |
| XLogP | -4.70 |
| TPSA | 214.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 505.24 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trizinc;2H-benzotriazole;diphosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trizinc;2H-benzotriazole;diphosphate?
The IUPAC name of trizinc;2H-benzotriazole;diphosphate (CID 159936185) is trizinc;2H-benzotriazole;diphosphate.
What is the SMILES notation for trizinc;2H-benzotriazole;diphosphate?
The canonical SMILES for trizinc;2H-benzotriazole;diphosphate is O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Zn+2].[Zn+2].[Zn+2].c1ccc2n[nH]nc2c1.
What is the InChIKey of trizinc;2H-benzotriazole;diphosphate?
The InChIKey is OAGXUZWVNJMKKU-UHFFFAOYSA-H. The full InChI is InChI=1S/C6H5N3.2H3O4P.3Zn/c1-2-4-6-5(3-1)7-9-8-6;2*1-5(2,3)4;;;/h1-4H,(H,7,8,9);2*(H3,1,2,3,4);;;/q;;;3*+2/p-6.
What are the key properties of trizinc;2H-benzotriazole;diphosphate?
trizinc;2H-benzotriazole;diphosphate has a molecular weight of 505.24 g/mol, XLogP of -4.70, 0 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for trizinc;2H-benzotriazole;diphosphate is sourced from PubChem (CID 159936185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).