C14H24BNO4 — CID 159937100
[5-[[3-ethoxypropyl(methyl)amino]methyl]-2-methoxyphenyl]boronic acid (PubChem CID 159937100) has the molecular formula C14H24BNO4 and a molecular weight of 281.16 g/mol. Its IUPAC name is [5-[[3-ethoxypropyl(methyl)amino]methyl]-2-methoxyphenyl]boronic acid.
| Compound Name | [5-[[3-ethoxypropyl(methyl)amino]methyl]-2-methoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 159937100 |
| Molecular Formula | C14H24BNO4 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | [5-[[3-ethoxypropyl(methyl)amino]methyl]-2-methoxyphenyl]boronic acid |
| SMILES | CCOCCCN(C)Cc1ccc(OC)c(B(O)O)c1 |
| InChI | InChI=1S/C14H24BNO4/c1-4-20-9-5-8-16(2)11-12-6-7-14(19-3)13(10-12)15(17)18/h6-7,10,17-18H,4-5,8-9,11H2,1-3H3 |
| InChIKey | OAJWFABZANJDPZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|