C21H27ClN8O4 — CID 159938694
6-chloro-3-nitropyridin-2-amine;ethyl 2-[5-[3-(dimethylamino)pyrrolidin-1-yl]-1H-imidazo[4,5-b]pyridin-2-yl]acetate (PubChem CID 159938694) has the molecular formula C21H27ClN8O4 and a molecular weight of 490.95 g/mol. Its IUPAC name is 6-chloro-3-nitropyridin-2-amine;ethyl 2-[5-[3-(dimethylamino)pyrrolidin-1-yl]-1H-imidazo[4,5-b]pyridin-2-yl]acetate.
| Compound Name | 6-chloro-3-nitropyridin-2-amine;ethyl 2-[5-[3-(dimethylamino)pyrrolidin-1-yl]-1H-imidazo[4,5-b]pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 159938694 |
| Molecular Formula | C21H27ClN8O4 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 6-chloro-3-nitropyridin-2-amine;ethyl 2-[5-[3-(dimethylamino)pyrrolidin-1-yl]-1H-imidazo[4,5-b]pyridin-2-yl]acetate |
| SMILES | CCOC(=O)Cc1nc2nc(N3CCC(N(C)C)C3)ccc2[nH]1.Nc1nc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23N5O2.C5H4ClN3O2/c1-4-23-15(22)9-13-17-12-5-6-14(19-16(12)18-13)21-8-7-11(10-21)20(2)3;6-4-2-1-3(9(10)11)5(7)8-4/h5-6,11H,4,7-10H2,1-3H3,(H,17,18,19);1-2H,(H2,7,8) |
| InChIKey | OAPANYUOJIWUFX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 156.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|