About 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one
7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one (PubChem CID 159938990) has the molecular formula C21H20N2O3
and a molecular weight of 348.40 g/mol. Its IUPAC name is 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one |
| PubChem CID | 159938990 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one |
| SMILES | CC(C)(C)C(=O)Cc1ccc(C(=O)c2ccc3ncc(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C21H20N2O3/c1-21(2,3)18(24)10-13-4-6-14(7-5-13)20(26)15-8-9-16-17(11-15)23-19(25)12-22-16/h4-9,11-12H,10H2,1-3H3,(H,23,25) |
| InChIKey | XNQNMXOBGTWIBZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one?
The IUPAC name of 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one (CID 159938990) is 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one.
What is the SMILES notation for 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one?
The canonical SMILES for 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one is CC(C)(C)C(=O)Cc1ccc(C(=O)c2ccc3ncc(=O)[nH]c3c2)cc1.
What is the InChIKey of 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one?
The InChIKey is XNQNMXOBGTWIBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3/c1-21(2,3)18(24)10-13-4-6-14(7-5-13)20(26)15-8-9-16-17(11-15)23-19(25)12-22-16/h4-9,11-12H,10H2,1-3H3,(H,23,25).
What are the key properties of 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one?
7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one has a molecular weight of 348.40 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-(3,3-dimethyl-2-oxobutyl)benzoyl]-1H-quinoxalin-2-one is sourced from PubChem (CID 159938990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).