C14H26N8O3 — CID 159939259
butan-1-amine;N-butyl-1H-1,2,4-triazole-5-carboxamide;1H-1,2,4-triazole-5-carboxylic acid (PubChem CID 159939259) has the molecular formula C14H26N8O3 and a molecular weight of 354.42 g/mol. Its IUPAC name is butan-1-amine;N-butyl-1H-1,2,4-triazole-5-carboxamide;1H-1,2,4-triazole-5-carboxylic acid.
| Compound Name | butan-1-amine;N-butyl-1H-1,2,4-triazole-5-carboxamide;1H-1,2,4-triazole-5-carboxylic acid |
|---|---|
| PubChem CID | 159939259 |
| Molecular Formula | C14H26N8O3 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | butan-1-amine;N-butyl-1H-1,2,4-triazole-5-carboxamide;1H-1,2,4-triazole-5-carboxylic acid |
| SMILES | CCCCN.CCCCNC(=O)c1ncn[nH]1.O=C(O)c1ncn[nH]1 |
| InChI | InChI=1S/C7H12N4O.C4H11N.C3H3N3O2/c1-2-3-4-8-7(12)6-9-5-10-11-6;1-2-3-4-5;7-3(8)2-4-1-5-6-2/h5H,2-4H2,1H3,(H,8,12)(H,9,10,11);2-5H2,1H3;1H,(H,7,8)(H,4,5,6) |
| InChIKey | OAQVSDJMSOEDIJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 175.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|