C26H28F2N4O8S2 — CID 159939466
ethyl 2-(6-amino-7-fluoro-3-sulfanylidene-1,4-benzoxazin-4-yl)propanoate;ethyl 2-(7-fluoro-6-nitro-3-sulfanylidene-1,4-benzoxazin-4-yl)propanoate (PubChem CID 159939466) has the molecular formula C26H28F2N4O8S2 and a molecular weight of 626.66 g/mol. Its IUPAC name is ethyl 2-(6-amino-7-fluoro-3-sulfanylidene-1,4-benzoxazin-4-yl)propanoate;ethyl 2-(7-fluoro-6-nitro-3-sulfanylidene-1,4-benzoxazin-4-yl)propanoate.
| Compound Name | ethyl 2-(6-amino-7-fluoro-3-sulfanylidene-1,4-benzoxazin-4-yl)propanoate;ethyl 2-(7-fluoro-6-nitro-3-sulfanylidene-1,4-benzoxazin-4-yl)propanoate |
|---|---|
| PubChem CID | 159939466 |
| Molecular Formula | C26H28F2N4O8S2 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | ethyl 2-(6-amino-7-fluoro-3-sulfanylidene-1,4-benzoxazin-4-yl)propanoate;ethyl 2-(7-fluoro-6-nitro-3-sulfanylidene-1,4-benzoxazin-4-yl)propanoate |
| SMILES | CCOC(=O)C(C)N1C(=S)COc2cc(F)c(N)cc21.CCOC(=O)C(C)N1C(=S)COc2cc(F)c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C13H13FN2O5S.C13H15FN2O3S/c1-3-20-13(17)7(2)15-10-5-9(16(18)19)8(14)4-11(10)21-6-12(15)22;1-3-18-13(17)7(2)16-10-5-9(15)8(14)4-11(10)19-6-12(16)20/h4-5,7H,3,6H2,1-2H3;4-5,7H,3,6,15H2,1-2H3 |
| InChIKey | OARNLAGCSCMFKA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 146.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|