C21H22N2O5 — CID 15994039
5',8-dimethoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 15994039) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5',8-dimethoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | 5',8-dimethoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 15994039 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 5',8-dimethoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | COc1ccc2c(c1)C(C)(C)C1(C=Cc3cc([N+](=O)[O-])cc(OC)c3O1)N2C |
| InChI | InChI=1S/C21H22N2O5/c1-20(2)16-12-15(26-4)6-7-17(16)22(3)21(20)9-8-13-10-14(23(24)25)11-18(27-5)19(13)28-21/h6-12H,1-5H3 |
| InChIKey | REIRBIWLLFIURB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|