C27H24FNO2S — CID 159940416
1-[4-[[2-(4-fluorophenyl)-6-methyl-1-benzothiophen-3-yl]oxy]phenyl]piperidine-4-carbaldehyde (PubChem CID 159940416) has the molecular formula C27H24FNO2S and a molecular weight of 445.56 g/mol. Its IUPAC name is 1-[4-[[2-(4-fluorophenyl)-6-methyl-1-benzothiophen-3-yl]oxy]phenyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[4-[[2-(4-fluorophenyl)-6-methyl-1-benzothiophen-3-yl]oxy]phenyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 159940416 |
| Molecular Formula | C27H24FNO2S |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-[4-[[2-(4-fluorophenyl)-6-methyl-1-benzothiophen-3-yl]oxy]phenyl]piperidine-4-carbaldehyde |
| SMILES | Cc1ccc2c(Oc3ccc(N4CCC(C=O)CC4)cc3)c(-c3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C27H24FNO2S/c1-18-2-11-24-25(16-18)32-27(20-3-5-21(28)6-4-20)26(24)31-23-9-7-22(8-10-23)29-14-12-19(17-30)13-15-29/h2-11,16-17,19H,12-15H2,1H3 |
| InChIKey | NZCYREJFFIEHMB-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|