C10H16O5Si — CID 159941112
3-tert-butyl-6-hydroxysilylbenzene-1,2,4,5-tetrol (PubChem CID 159941112) has the molecular formula C10H16O5Si and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-tert-butyl-6-hydroxysilylbenzene-1,2,4,5-tetrol.
| Compound Name | 3-tert-butyl-6-hydroxysilylbenzene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 159941112 |
| Molecular Formula | C10H16O5Si |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-tert-butyl-6-hydroxysilylbenzene-1,2,4,5-tetrol |
| SMILES | CC(C)(C)c1c(O)c(O)c([SiH2]O)c(O)c1O |
| InChI | InChI=1S/C10H16O5Si/c1-10(2,3)4-5(11)7(13)9(16-15)8(14)6(4)12/h11-15H,16H2,1-3H3 |
| InChIKey | HWQZENYCIQLLAA-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|