C18H14BrF3N2O2 — CID 159941360
2-bromo-1-[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]-1,3,4-oxadiazol-2-yl]ethanol (PubChem CID 159941360) has the molecular formula C18H14BrF3N2O2 and a molecular weight of 427.22 g/mol. Its IUPAC name is 2-bromo-1-[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]-1,3,4-oxadiazol-2-yl]ethanol.
| Compound Name | 2-bromo-1-[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]-1,3,4-oxadiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 159941360 |
| Molecular Formula | C18H14BrF3N2O2 |
| Molecular Weight | 427.22 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 2-bromo-1-[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]-1,3,4-oxadiazol-2-yl]ethanol |
| SMILES | OC(CBr)c1nnc(-c2ccccc2Cc2ccc(C(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C18H14BrF3N2O2/c19-10-15(25)17-24-23-16(26-17)14-4-2-1-3-12(14)9-11-5-7-13(8-6-11)18(20,21)22/h1-8,15,25H,9-10H2 |
| InChIKey | UKECWYAZQFMFGK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.22 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|