About butan-2-one;2,2,2-trichloroacetaldehyde
butan-2-one;2,2,2-trichloroacetaldehyde (PubChem CID 159941514) has the molecular formula C6H9Cl3O2
and a molecular weight of 219.49 g/mol. Its IUPAC name is butan-2-one;2,2,2-trichloroacetaldehyde.
Molecular Properties
| Compound Name | butan-2-one;2,2,2-trichloroacetaldehyde |
| PubChem CID | 159941514 |
| Molecular Formula | C6H9Cl3O2 |
| Molecular Weight | 219.49 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | butan-2-one;2,2,2-trichloroacetaldehyde |
| SMILES | CCC(C)=O.O=CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H8O.C2HCl3O/c1-3-4(2)5;3-2(4,5)1-6/h3H2,1-2H3;1H |
| InChIKey | OAYCXBKUJKLEOV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;2,2,2-trichloroacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;2,2,2-trichloroacetaldehyde?
The IUPAC name of butan-2-one;2,2,2-trichloroacetaldehyde (CID 159941514) is butan-2-one;2,2,2-trichloroacetaldehyde.
What is the SMILES notation for butan-2-one;2,2,2-trichloroacetaldehyde?
The canonical SMILES for butan-2-one;2,2,2-trichloroacetaldehyde is CCC(C)=O.O=CC(Cl)(Cl)Cl.
What is the InChIKey of butan-2-one;2,2,2-trichloroacetaldehyde?
The InChIKey is OAYCXBKUJKLEOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C2HCl3O/c1-3-4(2)5;3-2(4,5)1-6/h3H2,1-2H3;1H.
What are the key properties of butan-2-one;2,2,2-trichloroacetaldehyde?
butan-2-one;2,2,2-trichloroacetaldehyde has a molecular weight of 219.49 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;2,2,2-trichloroacetaldehyde is sourced from PubChem (CID 159941514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).