About 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol
3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol (PubChem CID 159941982) has the molecular formula C18H10BrCl3N2O2
and a molecular weight of 472.55 g/mol. Its IUPAC name is 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol.
Molecular Properties
| Compound Name | 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol |
| PubChem CID | 159941982 |
| Molecular Formula | C18H10BrCl3N2O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 469.90 |
| IUPAC Name | 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol |
| SMILES | Oc1ccc2cc(Br)cnc2c1Cl.Oc1ccc2cc(Cl)cnc2c1Cl |
| InChI | InChI=1S/C9H5BrClNO.C9H5Cl2NO/c2*10-6-3-5-1-2-7(13)8(11)9(5)12-4-6/h2*1-4,13H |
| InChIKey | OAZNKORPZOCDPR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol?
The IUPAC name of 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol (CID 159941982) is 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol.
What is the SMILES notation for 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol?
The canonical SMILES for 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol is Oc1ccc2cc(Br)cnc2c1Cl.Oc1ccc2cc(Cl)cnc2c1Cl.
What is the InChIKey of 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol?
The InChIKey is OAZNKORPZOCDPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrClNO.C9H5Cl2NO/c2*10-6-3-5-1-2-7(13)8(11)9(5)12-4-6/h2*1-4,13H.
What are the key properties of 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol?
3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol has a molecular weight of 472.55 g/mol, XLogP of 6.60, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-8-chloroquinolin-7-ol;3,8-dichloroquinolin-7-ol is sourced from PubChem (CID 159941982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).