C54H34LiN2OS+ — CID 159942085
lithium;1-(9,10-dinaphthalen-2-ylanthracen-2-yl)-[1]benzothiolo[2,3-c]pyridine;quinolin-1-ium-8-olate (PubChem CID 159942085) has the molecular formula C54H34LiN2OS+ and a molecular weight of 765.89 g/mol. Its IUPAC name is lithium;1-(9,10-dinaphthalen-2-ylanthracen-2-yl)-[1]benzothiolo[2,3-c]pyridine;quinolin-1-ium-8-olate.
| Compound Name | lithium;1-(9,10-dinaphthalen-2-ylanthracen-2-yl)-[1]benzothiolo[2,3-c]pyridine;quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 159942085 |
| Molecular Formula | C54H34LiN2OS+ |
| Molecular Weight | 765.89 g/mol |
| Exact Mass | 765.25 |
| IUPAC Name | lithium;1-(9,10-dinaphthalen-2-ylanthracen-2-yl)-[1]benzothiolo[2,3-c]pyridine;quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1cccc2ccc[nH+]c12.c1ccc2cc(-c3c4ccccc4c(-c4ccc5ccccc5c4)c4cc(-c5nccc6c5sc5ccccc56)ccc34)ccc2c1 |
| InChI | InChI=1S/C45H27NS.C9H7NO.Li/c1-3-11-30-25-32(19-17-28(30)9-1)42-36-14-5-6-15-37(36)43(33-20-18-29-10-2-4-12-31(29)26-33)40-27-34(21-22-38(40)42)44-45-39(23-24-46-44)35-13-7-8-16-41(35)47-45;11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-27H;1-6,11H;/q;;+1 |
| InChIKey | OAZWTVJZWLVFKM-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.89 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|