C38H72O4 — CID 159943059
4-heptyl-2-(4-propylcyclohexyl)-1,3-dioxane;4-pentyl-2-(4-propylcyclohexyl)-1,3-dioxane (PubChem CID 159943059) has the molecular formula C38H72O4 and a molecular weight of 592.99 g/mol. Its IUPAC name is 4-heptyl-2-(4-propylcyclohexyl)-1,3-dioxane;4-pentyl-2-(4-propylcyclohexyl)-1,3-dioxane.
| Compound Name | 4-heptyl-2-(4-propylcyclohexyl)-1,3-dioxane;4-pentyl-2-(4-propylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 159943059 |
| Molecular Formula | C38H72O4 |
| Molecular Weight | 592.99 g/mol |
| Exact Mass | 592.54 |
| IUPAC Name | 4-heptyl-2-(4-propylcyclohexyl)-1,3-dioxane;4-pentyl-2-(4-propylcyclohexyl)-1,3-dioxane |
| SMILES | CCCCCC1CCOC(C2CCC(CCC)CC2)O1.CCCCCCCC1CCOC(C2CCC(CCC)CC2)O1 |
| InChI | InChI=1S/C20H38O2.C18H34O2/c1-3-5-6-7-8-10-19-15-16-21-20(22-19)18-13-11-17(9-4-2)12-14-18;1-3-5-6-8-17-13-14-19-18(20-17)16-11-9-15(7-4-2)10-12-16/h17-20H,3-16H2,1-2H3;15-18H,3-14H2,1-2H3 |
| InChIKey | OBDDDHKTOGXRRM-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.99 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|