About N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane
N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane (PubChem CID 159944323) has the molecular formula C8H14N2OS
and a molecular weight of 186.28 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane |
| PubChem CID | 159944323 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane |
| SMILES | C.C=CC(=O)N(C)C1=NCCS1 |
| InChI | InChI=1S/C7H10N2OS.CH4/c1-3-6(10)9(2)7-8-4-5-11-7;/h3H,1,4-5H2,2H3;1H4 |
| InChIKey | XKJMHWBNTBCPTI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane?
The IUPAC name of N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane (CID 159944323) is N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane.
What is the SMILES notation for N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane?
The canonical SMILES for N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane is C.C=CC(=O)N(C)C1=NCCS1.
What is the InChIKey of N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane?
The InChIKey is XKJMHWBNTBCPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2OS.CH4/c1-3-6(10)9(2)7-8-4-5-11-7;/h3H,1,4-5H2,2H3;1H4.
What are the key properties of N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane?
N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane has a molecular weight of 186.28 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1,3-thiazol-2-yl)-N-methylprop-2-enamide;methane is sourced from PubChem (CID 159944323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).