C23H35N3O4S2 — CID 159945627
9-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-N-hydroxy-8-oxo-N-propan-2-ylnonanamide (PubChem CID 159945627) has the molecular formula C23H35N3O4S2 and a molecular weight of 481.68 g/mol. Its IUPAC name is 9-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-N-hydroxy-8-oxo-N-propan-2-ylnonanamide.
| Compound Name | 9-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-N-hydroxy-8-oxo-N-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 159945627 |
| Molecular Formula | C23H35N3O4S2 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 9-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-N-hydroxy-8-oxo-N-propan-2-ylnonanamide |
| SMILES | CC(C)N(O)C(=O)CCCCCCC(=O)Cc1ncc(SCc2ncc(C(C)(C)C)o2)s1 |
| InChI | InChI=1S/C23H35N3O4S2/c1-16(2)26(29)21(28)11-9-7-6-8-10-17(27)12-20-25-14-22(32-20)31-15-19-24-13-18(30-19)23(3,4)5/h13-14,16,29H,6-12,15H2,1-5H3 |
| InChIKey | OBLHPIAOFADPFA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|