About tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine
tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine (PubChem CID 159945817) has the molecular formula C28H40N2
and a molecular weight of 404.64 g/mol. Its IUPAC name is tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine.
Molecular Properties
| Compound Name | tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine |
| PubChem CID | 159945817 |
| Molecular Formula | C28H40N2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine |
| SMILES | CC(C)(C)c1ccccc1.CC(C)(C)c1ccccn1.CC(C)(C)c1ccncc1 |
| InChI | InChI=1S/C10H14.2C9H13N/c1-10(2,3)9-7-5-4-6-8-9;1-9(2,3)8-4-6-10-7-5-8;1-9(2,3)8-6-4-5-7-10-8/h4-8H,1-3H3;2*4-7H,1-3H3 |
| InChIKey | OBLVXYYHJQXNKK-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine?
The IUPAC name of tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine (CID 159945817) is tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine.
What is the SMILES notation for tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine?
The canonical SMILES for tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine is CC(C)(C)c1ccccc1.CC(C)(C)c1ccccn1.CC(C)(C)c1ccncc1.
What is the InChIKey of tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine?
The InChIKey is OBLVXYYHJQXNKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.2C9H13N/c1-10(2,3)9-7-5-4-6-8-9;1-9(2,3)8-4-6-10-7-5-8;1-9(2,3)8-6-4-5-7-10-8/h4-8H,1-3H3;2*4-7H,1-3H3.
What are the key properties of tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine?
tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine has a molecular weight of 404.64 g/mol, XLogP of 7.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylbenzene;2-tert-butylpyridine;4-tert-butylpyridine is sourced from PubChem (CID 159945817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).