C15H14F3N3O3 — CID 15994592
N-[4-[[2,3,5-trifluoro-6-(2-hydroxyethylamino)-4-pyridinyl]oxy]phenyl]acetamide (PubChem CID 15994592) has the molecular formula C15H14F3N3O3 and a molecular weight of 341.29 g/mol. Its IUPAC name is N-[4-[[2,3,5-trifluoro-6-(2-hydroxyethylamino)-4-pyridinyl]oxy]phenyl]acetamide.
| Compound Name | N-[4-[[2,3,5-trifluoro-6-(2-hydroxyethylamino)-4-pyridinyl]oxy]phenyl]acetamide |
|---|---|
| PubChem CID | 15994592 |
| Molecular Formula | C15H14F3N3O3 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[4-[[2,3,5-trifluoro-6-(2-hydroxyethylamino)-4-pyridinyl]oxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Oc2c(F)c(F)nc(NCCO)c2F)cc1 |
| InChI | InChI=1S/C15H14F3N3O3/c1-8(23)20-9-2-4-10(5-3-9)24-13-11(16)14(18)21-15(12(13)17)19-6-7-22/h2-5,22H,6-7H2,1H3,(H,19,21)(H,20,23) |
| InChIKey | ZCVZASPXSFADEH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|