C13H19ClO — CID 159946693
formyl chloride;1,3,5-triethylbenzene (PubChem CID 159946693) has the molecular formula C13H19ClO and a molecular weight of 226.75 g/mol. Its IUPAC name is formyl chloride;1,3,5-triethylbenzene.
| Compound Name | formyl chloride;1,3,5-triethylbenzene |
|---|---|
| PubChem CID | 159946693 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | formyl chloride;1,3,5-triethylbenzene |
| SMILES | CCc1cc(CC)cc(CC)c1.O=CCl |
| InChI | InChI=1S/C12H18.CHClO/c1-4-10-7-11(5-2)9-12(6-3)8-10;2-1-3/h7-9H,4-6H2,1-3H3;1H |
| InChIKey | OBORVQWFGKFKTP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|