C11H19F2NO2 — CID 159947221
N-[(2R,3S,5S)-6-(difluoromethyl)-2,4,5-trimethyloxan-3-yl]acetamide (PubChem CID 159947221) has the molecular formula C11H19F2NO2 and a molecular weight of 235.27 g/mol. Its IUPAC name is N-[(2R,3S,5S)-6-(difluoromethyl)-2,4,5-trimethyloxan-3-yl]acetamide.
| Compound Name | N-[(2R,3S,5S)-6-(difluoromethyl)-2,4,5-trimethyloxan-3-yl]acetamide |
|---|---|
| PubChem CID | 159947221 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-[(2R,3S,5S)-6-(difluoromethyl)-2,4,5-trimethyloxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(C)[C@H](C)C(C(F)F)O[C@@H]1C |
| InChI | InChI=1S/C11H19F2NO2/c1-5-6(2)10(11(12)13)16-7(3)9(5)14-8(4)15/h5-7,9-11H,1-4H3,(H,14,15)/t5?,6-,7+,9-,10?/m0/s1 |
| InChIKey | OBQITCOKJWYCIS-MGXUXPTCSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |