About 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide
4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide (PubChem CID 159949723) has the molecular formula C18H14N4O2
and a molecular weight of 318.34 g/mol. Its IUPAC name is 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide |
| PubChem CID | 159949723 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(C(N)=O)c(-c2ccncc2)cc1-c1ccncc1 |
| InChI | InChI=1S/C18H14N4O2/c19-17(23)15-10-16(18(20)24)14(12-3-7-22-8-4-12)9-13(15)11-1-5-21-6-2-11/h1-10H,(H2,19,23)(H2,20,24) |
| InChIKey | OBYIYBRTOBFFEY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide?
The IUPAC name of 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide (CID 159949723) is 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide.
What is the SMILES notation for 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide?
The canonical SMILES for 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide is NC(=O)c1cc(C(N)=O)c(-c2ccncc2)cc1-c1ccncc1.
What is the InChIKey of 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide?
The InChIKey is OBYIYBRTOBFFEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O2/c19-17(23)15-10-16(18(20)24)14(12-3-7-22-8-4-12)9-13(15)11-1-5-21-6-2-11/h1-10H,(H2,19,23)(H2,20,24).
What are the key properties of 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide?
4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide has a molecular weight of 318.34 g/mol, XLogP of 2.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide is sourced from PubChem (CID 159949723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).