C18H14N4O2 — CID 159949723
4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide (PubChem CID 159949723) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide.
| Compound Name | 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 159949723 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4,6-dipyridin-4-ylbenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(C(N)=O)c(-c2ccncc2)cc1-c1ccncc1 |
| InChI | InChI=1S/C18H14N4O2/c19-17(23)15-10-16(18(20)24)14(12-3-7-22-8-4-12)9-13(15)11-1-5-21-6-2-11/h1-10H,(H2,19,23)(H2,20,24) |
| InChIKey | OBYIYBRTOBFFEY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |