C26H44N2O — CID 159951364
1,2,2,6,6-pentamethylpiperidine;phenyl-(2,2,6,6-tetramethylpiperidin-1-yl)methanone (PubChem CID 159951364) has the molecular formula C26H44N2O and a molecular weight of 400.65 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethylpiperidine;phenyl-(2,2,6,6-tetramethylpiperidin-1-yl)methanone.
| Compound Name | 1,2,2,6,6-pentamethylpiperidine;phenyl-(2,2,6,6-tetramethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 159951364 |
| Molecular Formula | C26H44N2O |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.35 |
| IUPAC Name | 1,2,2,6,6-pentamethylpiperidine;phenyl-(2,2,6,6-tetramethylpiperidin-1-yl)methanone |
| SMILES | CC1(C)CCCC(C)(C)N1C(=O)c1ccccc1.CN1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C16H23NO.C10H21N/c1-15(2)11-8-12-16(3,4)17(15)14(18)13-9-6-5-7-10-13;1-9(2)7-6-8-10(3,4)11(9)5/h5-7,9-10H,8,11-12H2,1-4H3;6-8H2,1-5H3 |
| InChIKey | OCDQAYYUAPSOES-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |