C26H29FN4O2 — CID 15995206
N-(4-fluorophenyl)-N'-[4-methyl-2-(4-methylpiperidin-1-yl)quinolin-6-yl]butanediamide (PubChem CID 15995206) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N'-[4-methyl-2-(4-methylpiperidin-1-yl)quinolin-6-yl]butanediamide.
| Compound Name | N-(4-fluorophenyl)-N'-[4-methyl-2-(4-methylpiperidin-1-yl)quinolin-6-yl]butanediamide |
|---|---|
| PubChem CID | 15995206 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | N-(4-fluorophenyl)-N'-[4-methyl-2-(4-methylpiperidin-1-yl)quinolin-6-yl]butanediamide |
| SMILES | Cc1cc(N2CCC(C)CC2)nc2ccc(NC(=O)CCC(=O)Nc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C26H29FN4O2/c1-17-11-13-31(14-12-17)24-15-18(2)22-16-21(7-8-23(22)30-24)29-26(33)10-9-25(32)28-20-5-3-19(27)4-6-20/h3-8,15-17H,9-14H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | FMVHIPVBYLUJRH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |