C19H22O2 — CID 159952596
2-[(1R,2R,3R,4S)-3-propan-2-yl-2-bicyclo[2.2.1]heptanyl]indene-1,3-dione (PubChem CID 159952596) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[(1R,2R,3R,4S)-3-propan-2-yl-2-bicyclo[2.2.1]heptanyl]indene-1,3-dione.
| Compound Name | 2-[(1R,2R,3R,4S)-3-propan-2-yl-2-bicyclo[2.2.1]heptanyl]indene-1,3-dione |
|---|---|
| PubChem CID | 159952596 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-[(1R,2R,3R,4S)-3-propan-2-yl-2-bicyclo[2.2.1]heptanyl]indene-1,3-dione |
| SMILES | CC(C)[C@@H]1[C@H]2CC[C@H](C2)[C@H]1C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H22O2/c1-10(2)15-11-7-8-12(9-11)16(15)17-18(20)13-5-3-4-6-14(13)19(17)21/h3-6,10-12,15-17H,7-9H2,1-2H3/t11-,12+,15+,16+/m0/s1 |
| InChIKey | OCHOBNCIWHRHSO-UAXWRAGISA-N |
| XLogP | 4.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|