C30H33F3N4OS — CID 159952683
4-[4-[(2S)-1-[6-(5-hexylthiophen-2-yl)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-2-yl]-4-oxobutyl]benzonitrile (PubChem CID 159952683) has the molecular formula C30H33F3N4OS and a molecular weight of 554.68 g/mol. Its IUPAC name is 4-[4-[(2S)-1-[6-(5-hexylthiophen-2-yl)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-2-yl]-4-oxobutyl]benzonitrile.
| Compound Name | 4-[4-[(2S)-1-[6-(5-hexylthiophen-2-yl)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-2-yl]-4-oxobutyl]benzonitrile |
|---|---|
| PubChem CID | 159952683 |
| Molecular Formula | C30H33F3N4OS |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 4-[4-[(2S)-1-[6-(5-hexylthiophen-2-yl)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-2-yl]-4-oxobutyl]benzonitrile |
| SMILES | CCCCCCc1ccc(-c2cc(N3CCC[C@H]3C(=O)CCCc3ccc(C#N)cc3)nc(C(F)(F)F)n2)s1 |
| InChI | InChI=1S/C30H33F3N4OS/c1-2-3-4-5-9-23-16-17-27(39-23)24-19-28(36-29(35-24)30(31,32)33)37-18-7-10-25(37)26(38)11-6-8-21-12-14-22(20-34)15-13-21/h12-17,19,25H,2-11,18H2,1H3/t25-/m0/s1 |
| InChIKey | ALFQKJWRNLZHAF-VWLOTQADSA-N |
| XLogP | 7.78 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|