C20H20Cl2F2NO2+ — CID 159952741
1-[3-(cyclopropylmethoxy)-4-(2,2-difluoroethyl)phenyl]-2-(3,5-dichloro-1-methylpyridin-1-ium-4-yl)ethanone (PubChem CID 159952741) has the molecular formula C20H20Cl2F2NO2+ and a molecular weight of 415.29 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)-4-(2,2-difluoroethyl)phenyl]-2-(3,5-dichloro-1-methylpyridin-1-ium-4-yl)ethanone.
| Compound Name | 1-[3-(cyclopropylmethoxy)-4-(2,2-difluoroethyl)phenyl]-2-(3,5-dichloro-1-methylpyridin-1-ium-4-yl)ethanone |
|---|---|
| PubChem CID | 159952741 |
| Molecular Formula | C20H20Cl2F2NO2+ |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)-4-(2,2-difluoroethyl)phenyl]-2-(3,5-dichloro-1-methylpyridin-1-ium-4-yl)ethanone |
| SMILES | C[n+]1cc(Cl)c(CC(=O)c2ccc(CC(F)F)c(OCC3CC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2F2NO2/c1-25-9-16(21)15(17(22)10-25)8-18(26)13-4-5-14(7-20(23)24)19(6-13)27-11-12-2-3-12/h4-6,9-10,12,20H,2-3,7-8,11H2,1H3/q+1 |
| InChIKey | WZLUESQBCWLAFT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|