C28H24N6O — CID 159952783
(3Z)-3-ethenyl-1-[6-[4-[(3-methyl-2H-indazol-5-yl)amino]pyrimidin-2-yl]-1H-indol-2-yl]hexa-3,5-dien-1-one (PubChem CID 159952783) has the molecular formula C28H24N6O and a molecular weight of 460.54 g/mol. Its IUPAC name is (3Z)-3-ethenyl-1-[6-[4-[(3-methyl-2H-indazol-5-yl)amino]pyrimidin-2-yl]-1H-indol-2-yl]hexa-3,5-dien-1-one.
| Compound Name | (3Z)-3-ethenyl-1-[6-[4-[(3-methyl-2H-indazol-5-yl)amino]pyrimidin-2-yl]-1H-indol-2-yl]hexa-3,5-dien-1-one |
|---|---|
| PubChem CID | 159952783 |
| Molecular Formula | C28H24N6O |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | (3Z)-3-ethenyl-1-[6-[4-[(3-methyl-2H-indazol-5-yl)amino]pyrimidin-2-yl]-1H-indol-2-yl]hexa-3,5-dien-1-one |
| SMILES | C=C/C=C(\C=C)CC(=O)c1cc2ccc(-c3nccc(Nc4ccc5n[nH]c(C)c5c4)n3)cc2[nH]1 |
| InChI | InChI=1S/C28H24N6O/c1-4-6-18(5-2)13-26(35)25-14-19-7-8-20(15-24(19)31-25)28-29-12-11-27(32-28)30-21-9-10-23-22(16-21)17(3)33-34-23/h4-12,14-16,31H,1-2,13H2,3H3,(H,33,34)(H,29,30,32)/b18-6+ |
| InChIKey | OCIBLCSBJDNQBB-NGYBGAFCSA-N |
| XLogP | 6.42 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|