C25H26N2O3 — CID 15995490
2-[2-(2-ethoxyphenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 15995490) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-[2-(2-ethoxyphenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 2-[2-(2-ethoxyphenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 15995490 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[2-(2-ethoxyphenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | CCOc1ccccc1C1N=C(c2ccc(OC)cc2)CC(c2ccccc2O)N1 |
| InChI | InChI=1S/C25H26N2O3/c1-3-30-24-11-7-5-9-20(24)25-26-21(17-12-14-18(29-2)15-13-17)16-22(27-25)19-8-4-6-10-23(19)28/h4-15,22,25,27-28H,3,16H2,1-2H3 |
| InChIKey | KZCJJZRQAGPNKE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|