C33H37NO4 — CID 15995617
methyl 4-[3,3,6,6-tetramethyl-10-[(4-methylphenyl)methyl]-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]benzoate (PubChem CID 15995617) has the molecular formula C33H37NO4 and a molecular weight of 511.66 g/mol. Its IUPAC name is methyl 4-[3,3,6,6-tetramethyl-10-[(4-methylphenyl)methyl]-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]benzoate.
| Compound Name | methyl 4-[3,3,6,6-tetramethyl-10-[(4-methylphenyl)methyl]-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]benzoate |
|---|---|
| PubChem CID | 15995617 |
| Molecular Formula | C33H37NO4 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | methyl 4-[3,3,6,6-tetramethyl-10-[(4-methylphenyl)methyl]-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C3=C(CC(C)(C)CC3=O)N(Cc3ccc(C)cc3)C3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C33H37NO4/c1-20-7-9-21(10-8-20)19-34-24-15-32(2,3)17-26(35)29(24)28(22-11-13-23(14-12-22)31(37)38-6)30-25(34)16-33(4,5)18-27(30)36/h7-14,28H,15-19H2,1-6H3 |
| InChIKey | YYLHSMSANAXIEG-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |