About 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane
7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane (PubChem CID 159956613) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane |
| PubChem CID | 159956613 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane |
| SMILES | C=S1CCC2(CC1)CNC2 |
| InChI | InChI=1S/C8H15NS/c1-10-4-2-8(3-5-10)6-9-7-8/h9H,1-7H2 |
| InChIKey | PKAPWMVZNXCMCB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane?
The IUPAC name of 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane (CID 159956613) is 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane.
What is the SMILES notation for 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane?
The canonical SMILES for 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane is C=S1CCC2(CC1)CNC2.
What is the InChIKey of 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane?
The InChIKey is PKAPWMVZNXCMCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-10-4-2-8(3-5-10)6-9-7-8/h9H,1-7H2.
What are the key properties of 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane?
7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane has a molecular weight of 157.28 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylidene-7λ4-thia-2-azaspiro[3.5]nonane is sourced from PubChem (CID 159956613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).