About trisodium;2-methylphenolate;4-methylphenolate
trisodium;2-methylphenolate;4-methylphenolate (PubChem CID 159956775) has the molecular formula C14H14Na3O2+
and a molecular weight of 283.23 g/mol. Its IUPAC name is trisodium;2-methylphenolate;4-methylphenolate.
Molecular Properties
| Compound Name | trisodium;2-methylphenolate;4-methylphenolate |
| PubChem CID | 159956775 |
| Molecular Formula | C14H14Na3O2+ |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | trisodium;2-methylphenolate;4-methylphenolate |
| SMILES | Cc1ccc([O-])cc1.Cc1ccccc1[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/2C7H8O.3Na/c1-6-2-4-7(8)5-3-6;1-6-4-2-3-5-7(6)8;;;/h2*2-5,8H,1H3;;;/q;;3*+1/p-2 |
| InChIKey | MJSKEKNFSNPDOZ-UHFFFAOYSA-L |
| XLogP | -6.85 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | -6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trisodium;2-methylphenolate;4-methylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;2-methylphenolate;4-methylphenolate?
The IUPAC name of trisodium;2-methylphenolate;4-methylphenolate (CID 159956775) is trisodium;2-methylphenolate;4-methylphenolate.
What is the SMILES notation for trisodium;2-methylphenolate;4-methylphenolate?
The canonical SMILES for trisodium;2-methylphenolate;4-methylphenolate is Cc1ccc([O-])cc1.Cc1ccccc1[O-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;2-methylphenolate;4-methylphenolate?
The InChIKey is MJSKEKNFSNPDOZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H8O.3Na/c1-6-2-4-7(8)5-3-6;1-6-4-2-3-5-7(6)8;;;/h2*2-5,8H,1H3;;;/q;;3*+1/p-2.
What are the key properties of trisodium;2-methylphenolate;4-methylphenolate?
trisodium;2-methylphenolate;4-methylphenolate has a molecular weight of 283.23 g/mol, XLogP of -6.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;2-methylphenolate;4-methylphenolate is sourced from PubChem (CID 159956775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).