About (Z)-but-2-ene;methane;2-methyladamantane
(Z)-but-2-ene;methane;2-methyladamantane (PubChem CID 159957845) has the molecular formula C20H46
and a molecular weight of 286.59 g/mol. Its IUPAC name is (Z)-but-2-ene;methane;2-methyladamantane.
Molecular Properties
| Compound Name | (Z)-but-2-ene;methane;2-methyladamantane |
| PubChem CID | 159957845 |
| Molecular Formula | C20H46 |
| Molecular Weight | 286.59 g/mol |
| Exact Mass | 286.36 |
| IUPAC Name | (Z)-but-2-ene;methane;2-methyladamantane |
| SMILES | C.C.C.C.C.C/C=C\C.CC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C11H18.C4H8.5CH4/c1-7-10-3-8-2-9(5-10)6-11(7)4-8;1-3-4-2;;;;;/h7-11H,2-6H2,1H3;3-4H,1-2H3;5*1H4/b;4-3-;;;;; |
| InChIKey | OCYFACBPYDFYJW-CIXOVYEPSA-N |
| XLogP | 7.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.59 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;methane;2-methyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;methane;2-methyladamantane?
The IUPAC name of (Z)-but-2-ene;methane;2-methyladamantane (CID 159957845) is (Z)-but-2-ene;methane;2-methyladamantane.
What is the SMILES notation for (Z)-but-2-ene;methane;2-methyladamantane?
The canonical SMILES for (Z)-but-2-ene;methane;2-methyladamantane is C.C.C.C.C.C/C=C\C.CC1C2CC3CC(C2)CC1C3.
What is the InChIKey of (Z)-but-2-ene;methane;2-methyladamantane?
The InChIKey is OCYFACBPYDFYJW-CIXOVYEPSA-N. The full InChI is InChI=1S/C11H18.C4H8.5CH4/c1-7-10-3-8-2-9(5-10)6-11(7)4-8;1-3-4-2;;;;;/h7-11H,2-6H2,1H3;3-4H,1-2H3;5*1H4/b;4-3-;;;;;.
What are the key properties of (Z)-but-2-ene;methane;2-methyladamantane?
(Z)-but-2-ene;methane;2-methyladamantane has a molecular weight of 286.59 g/mol, XLogP of 7.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;methane;2-methyladamantane is sourced from PubChem (CID 159957845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).