C20H21BrN4O2 — CID 159957961
4-(aminomethyl)-1H-quinolin-2-one;azane;4-(bromomethyl)-1H-quinolin-2-one (PubChem CID 159957961) has the molecular formula C20H21BrN4O2 and a molecular weight of 429.32 g/mol. Its IUPAC name is 4-(aminomethyl)-1H-quinolin-2-one;azane;4-(bromomethyl)-1H-quinolin-2-one.
| Compound Name | 4-(aminomethyl)-1H-quinolin-2-one;azane;4-(bromomethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 159957961 |
| Molecular Formula | C20H21BrN4O2 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 4-(aminomethyl)-1H-quinolin-2-one;azane;4-(bromomethyl)-1H-quinolin-2-one |
| SMILES | N.NCc1cc(=O)[nH]c2ccccc12.O=c1cc(CBr)c2ccccc2[nH]1 |
| InChI | InChI=1S/C10H8BrNO.C10H10N2O.H3N/c2*11-6-7-5-10(13)12-9-4-2-1-3-8(7)9;/h1-5H,6H2,(H,12,13);1-5H,6,11H2,(H,12,13);1H3 |
| InChIKey | MVORHOGOVCCGCU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|