About 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate
4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate (PubChem CID 159958339) has the molecular formula C19H14Br2N2O4
and a molecular weight of 494.14 g/mol. Its IUPAC name is 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate.
Molecular Properties
| Compound Name | 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate |
| PubChem CID | 159958339 |
| Molecular Formula | C19H14Br2N2O4 |
| Molecular Weight | 494.14 g/mol |
| Exact Mass | 491.93 |
| IUPAC Name | 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate |
| SMILES | COC(=O)c1ccc(Br)c2cc[nH]c12.O=C(O)c1ccc(Br)c2cc[nH]c12 |
| InChI | InChI=1S/C10H8BrNO2.C9H6BrNO2/c1-14-10(13)7-2-3-8(11)6-4-5-12-9(6)7;10-7-2-1-6(9(12)13)8-5(7)3-4-11-8/h2-5,12H,1H3;1-4,11H,(H,12,13) |
| InChIKey | OCZPZZGRZXKALX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.14 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate?
The IUPAC name of 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate (CID 159958339) is 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate.
What is the SMILES notation for 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate?
The canonical SMILES for 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate is COC(=O)c1ccc(Br)c2cc[nH]c12.O=C(O)c1ccc(Br)c2cc[nH]c12.
What is the InChIKey of 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate?
The InChIKey is OCZPZZGRZXKALX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrNO2.C9H6BrNO2/c1-14-10(13)7-2-3-8(11)6-4-5-12-9(6)7;10-7-2-1-6(9(12)13)8-5(7)3-4-11-8/h2-5,12H,1H3;1-4,11H,(H,12,13).
What are the key properties of 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate?
4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate has a molecular weight of 494.14 g/mol, XLogP of 5.35, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1H-indole-7-carboxylic acid;methyl 4-bromo-1H-indole-7-carboxylate is sourced from PubChem (CID 159958339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).