C30H32FNO2 — CID 15996025
10-(4-fluorophenyl)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 15996025) has the molecular formula C30H32FNO2 and a molecular weight of 457.59 g/mol. Its IUPAC name is 10-(4-fluorophenyl)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(4-fluorophenyl)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 15996025 |
| Molecular Formula | C30H32FNO2 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 10-(4-fluorophenyl)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)N(c3ccc(F)cc3)C3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C30H32FNO2/c1-18-6-8-19(9-7-18)26-27-22(14-29(2,3)16-24(27)33)32(21-12-10-20(31)11-13-21)23-15-30(4,5)17-25(34)28(23)26/h6-13,26H,14-17H2,1-5H3 |
| InChIKey | UOMTYUNMUPZVNM-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |