C30H20Br2Cl2F4O — CID 159961182
1-[3-bromo-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene;2-(bromomethyl)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxirane (PubChem CID 159961182) has the molecular formula C30H20Br2Cl2F4O and a molecular weight of 703.20 g/mol. Its IUPAC name is 1-[3-bromo-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene;2-(bromomethyl)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxirane.
| Compound Name | 1-[3-bromo-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene;2-(bromomethyl)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxirane |
|---|---|
| PubChem CID | 159961182 |
| Molecular Formula | C30H20Br2Cl2F4O |
| Molecular Weight | 703.20 g/mol |
| Exact Mass | 699.92 |
| IUPAC Name | 1-[3-bromo-1-(2-chlorophenyl)prop-1-en-2-yl]-2,4-difluorobenzene;2-(bromomethyl)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxirane |
| SMILES | Fc1ccc(C(=Cc2ccccc2Cl)CBr)c(F)c1.Fc1ccc(C2(CBr)OC2c2ccccc2Cl)c(F)c1 |
| InChI | InChI=1S/C15H10BrClF2O.C15H10BrClF2/c16-8-15(11-6-5-9(18)7-13(11)19)14(20-15)10-3-1-2-4-12(10)17;16-9-11(7-10-3-1-2-4-14(10)17)13-6-5-12(18)8-15(13)19/h1-7,14H,8H2;1-8H,9H2 |
| InChIKey | ODIVJABWBOORGA-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.20 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|